C28H31NO3 — CID 53382142
(2S,3S,4S,5S)-2-ethenyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine (PubChem CID 53382142) has the molecular formula C28H31NO3 and a molecular weight of 429.56 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2-ethenyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine.
| Compound Name | (2S,3S,4S,5S)-2-ethenyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
|---|---|
| PubChem CID | 53382142 |
| Molecular Formula | C28H31NO3 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (2S,3S,4S,5S)-2-ethenyl-3,4-bis(phenylmethoxy)-5-(phenylmethoxymethyl)pyrrolidine |
| SMILES | C=C[C@@H]1N[C@@H](COCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H31NO3/c1-2-25-27(31-19-23-14-8-4-9-15-23)28(32-20-24-16-10-5-11-17-24)26(29-25)21-30-18-22-12-6-3-7-13-22/h2-17,25-29H,1,18-21H2/t25-,26-,27-,28-/m0/s1 |
| InChIKey | VDBHXIVGPCGRDM-LJWNLINESA-N |
| XLogP | 4.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|