C21H16ClF8N3O5S — CID 53382501
3-amino-5-chloro-N-[(2,3-difluorophenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) (PubChem CID 53382501) has the molecular formula C21H16ClF8N3O5S and a molecular weight of 609.88 g/mol. Its IUPAC name is 3-amino-5-chloro-N-[(2,3-difluorophenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 3-amino-5-chloro-N-[(2,3-difluorophenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 53382501 |
| Molecular Formula | C21H16ClF8N3O5S |
| Molecular Weight | 609.88 g/mol |
| Exact Mass | 609.04 |
| IUPAC Name | 3-amino-5-chloro-N-[(2,3-difluorophenyl)methyl]-4,6-dimethylthieno[2,3-b]pyridine-2-carboxamide;bis(2,2,2-trifluoroacetic acid) |
| SMILES | Cc1nc2sc(C(=O)NCc3cccc(F)c3F)c(N)c2c(C)c1Cl.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H14ClF2N3OS.2C2HF3O2/c1-7-11-14(21)15(25-17(11)23-8(2)12(7)18)16(24)22-6-9-4-3-5-10(19)13(9)20;2*3-2(4,5)1(6)7/h3-5H,6,21H2,1-2H3,(H,22,24);2*(H,6,7) |
| InChIKey | GSUXZRXFSYXRFR-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.88 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |