C23H20N4OS — CID 53383485
2-[2-[1-(2-methylbenzimidazol-1-yl)ethyl]benzimidazol-1-yl]-1-thiophen-3-ylethanone (PubChem CID 53383485) has the molecular formula C23H20N4OS and a molecular weight of 400.51 g/mol. Its IUPAC name is 2-[2-[1-(2-methylbenzimidazol-1-yl)ethyl]benzimidazol-1-yl]-1-thiophen-3-ylethanone.
| Compound Name | 2-[2-[1-(2-methylbenzimidazol-1-yl)ethyl]benzimidazol-1-yl]-1-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 53383485 |
| Molecular Formula | C23H20N4OS |
| Molecular Weight | 400.51 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[2-[1-(2-methylbenzimidazol-1-yl)ethyl]benzimidazol-1-yl]-1-thiophen-3-ylethanone |
| SMILES | Cc1nc2ccccc2n1C(C)c1nc2ccccc2n1CC(=O)c1ccsc1 |
| InChI | InChI=1S/C23H20N4OS/c1-15(27-16(2)24-19-8-4-6-10-21(19)27)23-25-18-7-3-5-9-20(18)26(23)13-22(28)17-11-12-29-14-17/h3-12,14-15H,13H2,1-2H3 |
| InChIKey | COJQONCIDJYRCY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.51 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |