C18H22N2OS — CID 53383652
2-amino-5-benzyl-N-cyclohexylthiophene-3-carboxamide (PubChem CID 53383652) has the molecular formula C18H22N2OS and a molecular weight of 314.45 g/mol. Its IUPAC name is 2-amino-5-benzyl-N-cyclohexylthiophene-3-carboxamide.
| Compound Name | 2-amino-5-benzyl-N-cyclohexylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 53383652 |
| Molecular Formula | C18H22N2OS |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-amino-5-benzyl-N-cyclohexylthiophene-3-carboxamide |
| SMILES | Nc1sc(Cc2ccccc2)cc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H22N2OS/c19-17-16(18(21)20-14-9-5-2-6-10-14)12-15(22-17)11-13-7-3-1-4-8-13/h1,3-4,7-8,12,14H,2,5-6,9-11,19H2,(H,20,21) |
| InChIKey | SAXBTWNNBKJBDI-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |