C24H28ClFN2O2 — CID 53384157
2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N-cyclopentyl-2-(4-fluorophenyl)acetamide (PubChem CID 53384157) has the molecular formula C24H28ClFN2O2 and a molecular weight of 430.95 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N-cyclopentyl-2-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N-cyclopentyl-2-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 53384157 |
| Molecular Formula | C24H28ClFN2O2 |
| Molecular Weight | 430.95 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N-cyclopentyl-2-(4-fluorophenyl)acetamide |
| SMILES | O=C(NC1CCCC1)C(c1ccc(F)cc1)N1CCC(O)(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C24H28ClFN2O2/c25-19-9-7-18(8-10-19)24(30)13-15-28(16-14-24)22(17-5-11-20(26)12-6-17)23(29)27-21-3-1-2-4-21/h5-12,21-22,30H,1-4,13-16H2,(H,27,29) |
| InChIKey | UPNRNXUGDWDXTN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.95 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |