C19H19F3N2O3 — CID 53385197
1-methyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid (PubChem CID 53385197) has the molecular formula C19H19F3N2O3 and a molecular weight of 380.37 g/mol. Its IUPAC name is 1-methyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid.
| Compound Name | 1-methyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 53385197 |
| Molecular Formula | C19H19F3N2O3 |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 1-methyl-3-[2-(pyridin-2-ylmethoxy)ethyl]indole;2,2,2-trifluoroacetic acid |
| SMILES | Cn1cc(CCOCc2ccccn2)c2ccccc21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H18N2O.C2HF3O2/c1-19-12-14(16-7-2-3-8-17(16)19)9-11-20-13-15-6-4-5-10-18-15;3-2(4,5)1(6)7/h2-8,10,12H,9,11,13H2,1H3;(H,6,7) |
| InChIKey | VXYYUKZMTYEILU-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|