C25H21IN2 — CID 53386643
4-(5-iodo-7-methylindolo[1,2-a]quinolin-6-yl)-N,N-dimethylaniline (PubChem CID 53386643) has the molecular formula C25H21IN2 and a molecular weight of 476.36 g/mol. Its IUPAC name is 4-(5-iodo-7-methylindolo[1,2-a]quinolin-6-yl)-N,N-dimethylaniline.
| Compound Name | 4-(5-iodo-7-methylindolo[1,2-a]quinolin-6-yl)-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53386643 |
| Molecular Formula | C25H21IN2 |
| Molecular Weight | 476.36 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 4-(5-iodo-7-methylindolo[1,2-a]quinolin-6-yl)-N,N-dimethylaniline |
| SMILES | Cc1c2ccccc2n2c1c(-c1ccc(N(C)C)cc1)c(I)c1ccccc12 |
| InChI | InChI=1S/C25H21IN2/c1-16-19-8-4-6-10-21(19)28-22-11-7-5-9-20(22)24(26)23(25(16)28)17-12-14-18(15-13-17)27(2)3/h4-15H,1-3H3 |
| InChIKey | CFQGZVIEJZPVOZ-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 7.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.36 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|