C30H48N6O10 — CID 53387076
2-N,5-N-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-bis[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]pyrazine-2,5-dicarboxamide (PubChem CID 53387076) has the molecular formula C30H48N6O10 and a molecular weight of 652.75 g/mol. Its IUPAC name is 2-N,5-N-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-bis[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]pyrazine-2,5-dicarboxamide.
| Compound Name | 2-N,5-N-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-bis[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]pyrazine-2,5-dicarboxamide |
|---|---|
| PubChem CID | 53387076 |
| Molecular Formula | C30H48N6O10 |
| Molecular Weight | 652.75 g/mol |
| Exact Mass | 652.34 |
| IUPAC Name | 2-N,5-N-bis[(2,2-dimethyl-1,3-dioxolan-4-yl)methyl]-3,6-bis[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methylamino]pyrazine-2,5-dicarboxamide |
| SMILES | CC1(C)OCC(CNC(=O)c2nc(NC[C@H]3COC(C)(C)O3)c(C(=O)NCC3COC(C)(C)O3)nc2NC[C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C30H48N6O10/c1-27(2)39-13-17(43-27)9-31-23-21(25(37)33-11-19-15-41-29(5,6)45-19)36-24(32-10-18-14-40-28(3,4)44-18)22(35-23)26(38)34-12-20-16-42-30(7,8)46-20/h17-20H,9-16H2,1-8H3,(H,31,35)(H,32,36)(H,33,37)(H,34,38)/t17-,18-,19?,20?/m0/s1 |
| InChIKey | AIMDSQYNSRQZIP-VCAKUFKGSA-N |
| XLogP | 1.37 |
| TPSA | 181.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.75 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |