C24H33NO — CID 53387392
N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-3-propan-2-ylaniline (PubChem CID 53387392) has the molecular formula C24H33NO and a molecular weight of 351.53 g/mol. Its IUPAC name is N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-3-propan-2-ylaniline.
| Compound Name | N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-3-propan-2-ylaniline |
|---|---|
| PubChem CID | 53387392 |
| Molecular Formula | C24H33NO |
| Molecular Weight | 351.53 g/mol |
| Exact Mass | 351.26 |
| IUPAC Name | N-[2-(2,2-dimethyl-4-phenyloxan-4-yl)ethyl]-3-propan-2-ylaniline |
| SMILES | CC(C)c1cccc(NCCC2(c3ccccc3)CCOC(C)(C)C2)c1 |
| InChI | InChI=1S/C24H33NO/c1-19(2)20-9-8-12-22(17-20)25-15-13-24(21-10-6-5-7-11-21)14-16-26-23(3,4)18-24/h5-12,17,19,25H,13-16,18H2,1-4H3 |
| InChIKey | IPYFQOFBEXGHTQ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |