C23H40N2O — CID 7642436
N-[(2R)-1-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]propan-2-yl]-N',N'-diethylpropane-1,3-diamine (PubChem CID 7642436) has the molecular formula C23H40N2O and a molecular weight of 360.59 g/mol. Its IUPAC name is N-[(2R)-1-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]propan-2-yl]-N',N'-diethylpropane-1,3-diamine.
| Compound Name | N-[(2R)-1-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]propan-2-yl]-N',N'-diethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 7642436 |
| Molecular Formula | C23H40N2O |
| Molecular Weight | 360.59 g/mol |
| Exact Mass | 360.31 |
| IUPAC Name | N-[(2R)-1-[(4R)-2,2-dimethyl-4-phenyloxan-4-yl]propan-2-yl]-N',N'-diethylpropane-1,3-diamine |
| SMILES | CCN(CC)CCCN[C@H](C)C[C@@]1(c2ccccc2)CCOC(C)(C)C1 |
| InChI | InChI=1S/C23H40N2O/c1-6-25(7-2)16-11-15-24-20(3)18-23(21-12-9-8-10-13-21)14-17-26-22(4,5)19-23/h8-10,12-13,20,24H,6-7,11,14-19H2,1-5H3/t20-,23+/m1/s1 |
| InChIKey | PNIFHKSWZZWSNA-OFNKIYASSA-N |
| XLogP | 4.61 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|