C22H22N4O5 — CID 53388165
1-(4-benzoylpiperazin-1-yl)-2-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)(1,2-14C2)ethane-1,2-dione (PubChem CID 53388165) has the molecular formula C22H22N4O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is 1-(4-benzoylpiperazin-1-yl)-2-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)(1,2-14C2)ethane-1,2-dione.
| Compound Name | 1-(4-benzoylpiperazin-1-yl)-2-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)(1,2-14C2)ethane-1,2-dione |
|---|---|
| PubChem CID | 53388165 |
| Molecular Formula | C22H22N4O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 1-(4-benzoylpiperazin-1-yl)-2-(4,7-dimethoxy-1H-pyrrolo[2,3-c]pyridin-3-yl)(1,2-14C2)ethane-1,2-dione |
| SMILES | COc1ncc(OC)c2c([14C](=O)[14C](=O)N3CCN(C(=O)c4ccccc4)CC3)c[nH]c12 |
| InChI | InChI=1S/C22H22N4O5/c1-30-16-13-24-20(31-2)18-17(16)15(12-23-18)19(27)22(29)26-10-8-25(9-11-26)21(28)14-6-4-3-5-7-14/h3-7,12-13,23H,8-11H2,1-2H3/i19+2,22+2 |
| InChIKey | DBPMWRYLTBNCCE-KCYYEGOMSA-N |
| XLogP | 1.75 |
| TPSA | 104.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|