C11H15BrO6 — CID 53388454
methyl (3aS,4R,5R,7aS)-7-bromo-4,5-dihydroxy-2,2-dimethyl-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate (PubChem CID 53388454) has the molecular formula C11H15BrO6 and a molecular weight of 323.14 g/mol. Its IUPAC name is methyl (3aS,4R,5R,7aS)-7-bromo-4,5-dihydroxy-2,2-dimethyl-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate.
| Compound Name | methyl (3aS,4R,5R,7aS)-7-bromo-4,5-dihydroxy-2,2-dimethyl-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate |
|---|---|
| PubChem CID | 53388454 |
| Molecular Formula | C11H15BrO6 |
| Molecular Weight | 323.14 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | methyl (3aS,4R,5R,7aS)-7-bromo-4,5-dihydroxy-2,2-dimethyl-5,7a-dihydro-4H-1,3-benzodioxole-3a-carboxylate |
| SMILES | COC(=O)[C@@]12OC(C)(C)O[C@@H]1C(Br)=C[C@@H](O)[C@H]2O |
| InChI | InChI=1S/C11H15BrO6/c1-10(2)17-8-5(12)4-6(13)7(14)11(8,18-10)9(15)16-3/h4,6-8,13-14H,1-3H3/t6-,7-,8-,11+/m1/s1 |
| InChIKey | NIFWWWJEEWORTG-NKIIXMILSA-N |
| XLogP | 0.06 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.14 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |