C20H18N4O3 — CID 53390842
N-hydroxy-7-(4-phenylbenzoyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide (PubChem CID 53390842) has the molecular formula C20H18N4O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-hydroxy-7-(4-phenylbenzoyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-hydroxy-7-(4-phenylbenzoyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 53390842 |
| Molecular Formula | C20H18N4O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-hydroxy-7-(4-phenylbenzoyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2-carboxamide |
| SMILES | O=C(NO)c1cn2c(n1)CN(C(=O)c1ccc(-c3ccccc3)cc1)CC2 |
| InChI | InChI=1S/C20H18N4O3/c25-19(22-27)17-12-23-10-11-24(13-18(23)21-17)20(26)16-8-6-15(7-9-16)14-4-2-1-3-5-14/h1-9,12,27H,10-11,13H2,(H,22,25) |
| InChIKey | OGQGBQMGXFYPBR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|