C18H18N6O4 — CID 88894901
2-N-hydroxy-7-N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2,7-dicarboxamide (PubChem CID 88894901) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is 2-N-hydroxy-7-N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2,7-dicarboxamide.
| Compound Name | 2-N-hydroxy-7-N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2,7-dicarboxamide |
|---|---|
| PubChem CID | 88894901 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | 2-N-hydroxy-7-N-(5-methyl-3-phenyl-1,2-oxazol-4-yl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine-2,7-dicarboxamide |
| SMILES | Cc1onc(-c2ccccc2)c1NC(=O)N1CCn2cc(C(=O)NO)nc2C1 |
| InChI | InChI=1S/C18H18N6O4/c1-11-15(16(22-28-11)12-5-3-2-4-6-12)20-18(26)24-8-7-23-9-13(17(25)21-27)19-14(23)10-24/h2-6,9,27H,7-8,10H2,1H3,(H,20,26)(H,21,25) |
| InChIKey | VVINWRNSQWFLHS-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 125.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|