C23H19N3O — CID 53391597
(E)-3-(benzotriazol-1-yl)-1,5-diphenylpent-4-en-1-one (PubChem CID 53391597) has the molecular formula C23H19N3O and a molecular weight of 353.43 g/mol. Its IUPAC name is (E)-3-(benzotriazol-1-yl)-1,5-diphenylpent-4-en-1-one.
| Compound Name | (E)-3-(benzotriazol-1-yl)-1,5-diphenylpent-4-en-1-one |
|---|---|
| PubChem CID | 53391597 |
| Molecular Formula | C23H19N3O |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.15 |
| IUPAC Name | (E)-3-(benzotriazol-1-yl)-1,5-diphenylpent-4-en-1-one |
| SMILES | O=C(CC(/C=C/c1ccccc1)n1nnc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O/c27-23(19-11-5-2-6-12-19)17-20(16-15-18-9-3-1-4-10-18)26-22-14-8-7-13-21(22)24-25-26/h1-16,20H,17H2/b16-15+ |
| InChIKey | TVKXFPXPDSSCHI-FOCLMDBBSA-N |
| XLogP | 4.96 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |