C24H20ClN3O — CID 3343687
4-(benzotriazol-1-yl)-6-chloro-1,3-diphenylhex-5-en-1-one (PubChem CID 3343687) has the molecular formula C24H20ClN3O and a molecular weight of 401.90 g/mol. Its IUPAC name is 4-(benzotriazol-1-yl)-6-chloro-1,3-diphenylhex-5-en-1-one.
| Compound Name | 4-(benzotriazol-1-yl)-6-chloro-1,3-diphenylhex-5-en-1-one |
|---|---|
| PubChem CID | 3343687 |
| Molecular Formula | C24H20ClN3O |
| Molecular Weight | 401.90 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 4-(benzotriazol-1-yl)-6-chloro-1,3-diphenylhex-5-en-1-one |
| SMILES | O=C(CC(c1ccccc1)C(C=CCl)n1nnc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C24H20ClN3O/c25-16-15-22(28-23-14-8-7-13-21(23)26-27-28)20(18-9-3-1-4-10-18)17-24(29)19-11-5-2-6-12-19/h1-16,20,22H,17H2 |
| InChIKey | OGXDUPSXECGRPZ-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.90 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |