C12H24O3Si — CID 53391687
[(2S,3S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]oxiran-2-yl]methanol (PubChem CID 53391687) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is [(2S,3S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 53391687 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | [(2S,3S)-3-[(E)-3-[tert-butyl(dimethyl)silyl]oxyprop-1-enyl]oxiran-2-yl]methanol |
| SMILES | CC(C)(C)[Si](C)(C)OC/C=C/[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C12H24O3Si/c1-12(2,3)16(4,5)14-8-6-7-10-11(9-13)15-10/h6-7,10-11,13H,8-9H2,1-5H3/b7-6+/t10-,11-/m0/s1 |
| InChIKey | IAWQUPBZEIRKHY-JYLGIWJRSA-N |
| XLogP | 2.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|