C13H16BrN3O2 — CID 5339218
N'-[(E)-(4-bromophenyl)methylideneamino]-N-tert-butyloxamide (PubChem CID 5339218) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is N'-[(E)-(4-bromophenyl)methylideneamino]-N-tert-butyloxamide.
| Compound Name | N'-[(E)-(4-bromophenyl)methylideneamino]-N-tert-butyloxamide |
|---|---|
| PubChem CID | 5339218 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N'-[(E)-(4-bromophenyl)methylideneamino]-N-tert-butyloxamide |
| SMILES | CC(C)(C)NC(=O)C(=O)N/N=C/c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H16BrN3O2/c1-13(2,3)16-11(18)12(19)17-15-8-9-4-6-10(14)7-5-9/h4-8H,1-3H3,(H,16,18)(H,17,19)/b15-8+ |
| InChIKey | RWKRFZKIZRSRCJ-OVCLIPMQSA-N |
| XLogP | 1.81 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|