C30H32O8 — CID 53392822
[6-hydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-15-[(E)-3-methyl-4-oxobut-2-enyl]-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-8-yl] acetate (PubChem CID 53392822) has the molecular formula C30H32O8 and a molecular weight of 520.58 g/mol. Its IUPAC name is [6-hydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-15-[(E)-3-methyl-4-oxobut-2-enyl]-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-8-yl] acetate.
| Compound Name | [6-hydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-15-[(E)-3-methyl-4-oxobut-2-enyl]-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-8-yl] acetate |
|---|---|
| PubChem CID | 53392822 |
| Molecular Formula | C30H32O8 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.21 |
| IUPAC Name | [6-hydroxy-17,17-dimethyl-5-(3-methylbut-2-enyl)-15-[(E)-3-methyl-4-oxobut-2-enyl]-10,14-dioxo-3,16-dioxapentacyclo[11.4.1.02,11.02,15.04,9]octadeca-4,6,8,11-tetraen-8-yl] acetate |
| SMILES | CC(=O)Oc1cc(O)c(CC=C(C)C)c2c1C(=O)C1=CC3CC4C(C)(C)OC(C/C=C(\C)C=O)(C3=O)C14O2 |
| InChI | InChI=1S/C30H32O8/c1-15(2)7-8-19-21(33)13-22(36-17(4)32)24-25(34)20-11-18-12-23-28(5,6)38-29(27(18)35,10-9-16(3)14-31)30(20,23)37-26(19)24/h7,9,11,13-14,18,23,33H,8,10,12H2,1-6H3/b16-9+ |
| InChIKey | TUSLKFYWBPXQSS-CXUHLZMHSA-N |
| XLogP | 4.37 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|