C22H15F2NO4 — CID 53392991
N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3,5-difluorobenzamide (PubChem CID 53392991) has the molecular formula C22H15F2NO4 and a molecular weight of 395.36 g/mol. Its IUPAC name is N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3,5-difluorobenzamide.
| Compound Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 53392991 |
| Molecular Formula | C22H15F2NO4 |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3,5-difluorobenzamide |
| SMILES | O=C(/C=C/c1ccc(O)c(O)c1)c1ccc(NC(=O)c2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C22H15F2NO4/c23-16-10-15(11-17(24)12-16)22(29)25-18-5-3-14(4-6-18)19(26)7-1-13-2-8-20(27)21(28)9-13/h1-12,27-28H,(H,25,29)/b7-1+ |
| InChIKey | JYCVZSMDHWSIFW-LREOWRDNSA-N |
| XLogP | 4.52 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|