17-oxodocosa-7,10,13,15,19-pentaenoic acid

C22H32O3 — CID 53394416

IUPAC17-oxodocosa-7,10,13,15,19-pentaenoic acid
SMILESCCC=CCC(=O)C=CC=CCC=CCC=CCCCCCC(=O)O
InChIInChI=1S/C22H32O3/c1-2-3-15-18-21(23)19-16-13-11-9-7-5-4-6-8-10-12-14-17-20-22(24)25/h3,5-8,11,13,15-16,19H,2,4,9-10,12,14,17-18,20H2,1H3,(H,24,25)
InChIKeyPWVSFTLICCBISU-UHFFFAOYSA-N
MW344.50 g/mol
LogP5.95
Rot. Bonds15

About 17-oxodocosa-7,10,13,15,19-pentaenoic acid

17-oxodocosa-7,10,13,15,19-pentaenoic acid (PubChem CID 53394416) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 17-oxodocosa-7,10,13,15,19-pentaenoic acid.

Molecular Properties

Compound Name17-oxodocosa-7,10,13,15,19-pentaenoic acid
PubChem CID53394416
Molecular FormulaC22H32O3
Molecular Weight344.50 g/mol
Exact Mass344.24
IUPAC Name17-oxodocosa-7,10,13,15,19-pentaenoic acid
SMILESCCC=CCC(=O)C=CC=CCC=CCC=CCCCCCC(=O)O
InChIInChI=1S/C22H32O3/c1-2-3-15-18-21(23)19-16-13-11-9-7-5-4-6-8-10-12-14-17-20-22(24)25/h3,5-8,11,13,15-16,19H,2,4,9-10,12,14,17-18,20H2,1H3,(H,24,25)
InChIKeyPWVSFTLICCBISU-UHFFFAOYSA-N
XLogP5.95
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds15
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500344.50
LogP ≤ 55.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}

Analyze 17-oxodocosa-7,10,13,15,19-pentaenoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 17-oxodocosa-7,10,13,15,19-pentaenoic acid?
The IUPAC name of 17-oxodocosa-7,10,13,15,19-pentaenoic acid (CID 53394416) is 17-oxodocosa-7,10,13,15,19-pentaenoic acid.
What is the SMILES notation for 17-oxodocosa-7,10,13,15,19-pentaenoic acid?
The canonical SMILES for 17-oxodocosa-7,10,13,15,19-pentaenoic acid is CCC=CCC(=O)C=CC=CCC=CCC=CCCCCCC(=O)O.
What is the InChIKey of 17-oxodocosa-7,10,13,15,19-pentaenoic acid?
The InChIKey is PWVSFTLICCBISU-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H32O3/c1-2-3-15-18-21(23)19-16-13-11-9-7-5-4-6-8-10-12-14-17-20-22(24)25/h3,5-8,11,13,15-16,19H,2,4,9-10,12,14,17-18,20H2,1H3,(H,24,25).
What are the key properties of 17-oxodocosa-7,10,13,15,19-pentaenoic acid?
17-oxodocosa-7,10,13,15,19-pentaenoic acid has a molecular weight of 344.50 g/mol, XLogP of 5.95, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 17-oxodocosa-7,10,13,15,19-pentaenoic acid is sourced from PubChem (CID 53394416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).