C22H32O3 — CID 53394416
17-oxodocosa-7,10,13,15,19-pentaenoic acid (PubChem CID 53394416) has the molecular formula C22H32O3 and a molecular weight of 344.50 g/mol. Its IUPAC name is 17-oxodocosa-7,10,13,15,19-pentaenoic acid.
| Compound Name | 17-oxodocosa-7,10,13,15,19-pentaenoic acid |
|---|---|
| PubChem CID | 53394416 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 17-oxodocosa-7,10,13,15,19-pentaenoic acid |
| SMILES | CCC=CCC(=O)C=CC=CCC=CCC=CCCCCCC(=O)O |
| InChI | InChI=1S/C22H32O3/c1-2-3-15-18-21(23)19-16-13-11-9-7-5-4-6-8-10-12-14-17-20-22(24)25/h3,5-8,11,13,15-16,19H,2,4,9-10,12,14,17-18,20H2,1H3,(H,24,25) |
| InChIKey | PWVSFTLICCBISU-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|