C18H28O3 — CID 11380794
(10E,12Z,15Z)-9-oxooctadeca-10,12,15-trienoic acid (PubChem CID 11380794) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (10E,12Z,15Z)-9-oxooctadeca-10,12,15-trienoic acid.
| Compound Name | (10E,12Z,15Z)-9-oxooctadeca-10,12,15-trienoic acid |
|---|---|
| PubChem CID | 11380794 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (10E,12Z,15Z)-9-oxooctadeca-10,12,15-trienoic acid |
| SMILES | CC/C=C\C/C=C\C=C\C(=O)CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-5-6-8-11-14-17(19)15-12-9-7-10-13-16-18(20)21/h3-4,6,8,11,14H,2,5,7,9-10,12-13,15-16H2,1H3,(H,20,21)/b4-3-,8-6-,14-11+ |
| InChIKey | ACHDMUPTZYZIGR-CUHSZNQNSA-N |
| XLogP | 4.84 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|