C27H34N3O2S+ — CID 53396661
3-(4-methoxyanilino)-1-[4-methyl-2-(1-octylpyridin-1-ium-4-yl)-1,3-thiazol-5-yl]prop-2-en-1-one (PubChem CID 53396661) has the molecular formula C27H34N3O2S+ and a molecular weight of 464.66 g/mol. Its IUPAC name is 3-(4-methoxyanilino)-1-[4-methyl-2-(1-octylpyridin-1-ium-4-yl)-1,3-thiazol-5-yl]prop-2-en-1-one.
| Compound Name | 3-(4-methoxyanilino)-1-[4-methyl-2-(1-octylpyridin-1-ium-4-yl)-1,3-thiazol-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 53396661 |
| Molecular Formula | C27H34N3O2S+ |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | 3-(4-methoxyanilino)-1-[4-methyl-2-(1-octylpyridin-1-ium-4-yl)-1,3-thiazol-5-yl]prop-2-en-1-one |
| SMILES | CCCCCCCC[n+]1ccc(-c2nc(C)c(C(=O)C=CNc3ccc(OC)cc3)s2)cc1 |
| InChI | InChI=1S/C27H33N3O2S/c1-4-5-6-7-8-9-18-30-19-15-22(16-20-30)27-29-21(2)26(33-27)25(31)14-17-28-23-10-12-24(32-3)13-11-23/h10-17,19-20H,4-9,18H2,1-3H3/p+1 |
| InChIKey | WPQXJFYNWHMXKO-UHFFFAOYSA-O |
| XLogP | 6.58 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|