C5H3F4N3O2 — CID 53396771
3,5-bis(difluoromethyl)-4-nitro-1H-pyrazole (PubChem CID 53396771) has the molecular formula C5H3F4N3O2 and a molecular weight of 213.09 g/mol. Its IUPAC name is 3,5-bis(difluoromethyl)-4-nitro-1H-pyrazole.
| Compound Name | 3,5-bis(difluoromethyl)-4-nitro-1H-pyrazole |
|---|---|
| PubChem CID | 53396771 |
| Molecular Formula | C5H3F4N3O2 |
| Molecular Weight | 213.09 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 3,5-bis(difluoromethyl)-4-nitro-1H-pyrazole |
| SMILES | O=[N+]([O-])c1c(C(F)F)n[nH]c1C(F)F |
| InChI | InChI=1S/C5H3F4N3O2/c6-4(7)1-3(12(13)14)2(5(8)9)11-10-1/h4-5H,(H,10,11) |
| InChIKey | OVBVROPTVDHBPQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 71.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.09 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|