C11H15FN2O3S — CID 53398780
1-(5-fluoro-1H-indol-2-yl)-N-methylmethanamine;methanesulfonic acid (PubChem CID 53398780) has the molecular formula C11H15FN2O3S and a molecular weight of 274.32 g/mol. Its IUPAC name is 1-(5-fluoro-1H-indol-2-yl)-N-methylmethanamine;methanesulfonic acid.
| Compound Name | 1-(5-fluoro-1H-indol-2-yl)-N-methylmethanamine;methanesulfonic acid |
|---|---|
| PubChem CID | 53398780 |
| Molecular Formula | C11H15FN2O3S |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 1-(5-fluoro-1H-indol-2-yl)-N-methylmethanamine;methanesulfonic acid |
| SMILES | CNCc1cc2cc(F)ccc2[nH]1.CS(=O)(=O)O |
| InChI | InChI=1S/C10H11FN2.CH4O3S/c1-12-6-9-5-7-4-8(11)2-3-10(7)13-9;1-5(2,3)4/h2-5,12-13H,6H2,1H3;1H3,(H,2,3,4) |
| InChIKey | XZAIUGDKSLKTGU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|