C12H12FNO2 — CID 68676585
methyl 3-(5-fluoro-1H-indol-2-yl)propanoate (PubChem CID 68676585) has the molecular formula C12H12FNO2 and a molecular weight of 221.23 g/mol. Its IUPAC name is methyl 3-(5-fluoro-1H-indol-2-yl)propanoate.
| Compound Name | methyl 3-(5-fluoro-1H-indol-2-yl)propanoate |
|---|---|
| PubChem CID | 68676585 |
| Molecular Formula | C12H12FNO2 |
| Molecular Weight | 221.23 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | methyl 3-(5-fluoro-1H-indol-2-yl)propanoate |
| SMILES | COC(=O)CCc1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C12H12FNO2/c1-16-12(15)5-3-10-7-8-6-9(13)2-4-11(8)14-10/h2,4,6-7,14H,3,5H2,1H3 |
| InChIKey | GYFYRRCDQDDGQE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |