C19H20BrN3O — CID 53416531
1-benzyl-3-(2-bromo-4-methoxyphenyl)-4-ethylpyrazol-5-amine (PubChem CID 53416531) has the molecular formula C19H20BrN3O and a molecular weight of 386.29 g/mol. Its IUPAC name is 1-benzyl-3-(2-bromo-4-methoxyphenyl)-4-ethylpyrazol-5-amine.
| Compound Name | 1-benzyl-3-(2-bromo-4-methoxyphenyl)-4-ethylpyrazol-5-amine |
|---|---|
| PubChem CID | 53416531 |
| Molecular Formula | C19H20BrN3O |
| Molecular Weight | 386.29 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 1-benzyl-3-(2-bromo-4-methoxyphenyl)-4-ethylpyrazol-5-amine |
| SMILES | CCc1c(-c2ccc(OC)cc2Br)nn(Cc2ccccc2)c1N |
| InChI | InChI=1S/C19H20BrN3O/c1-3-15-18(16-10-9-14(24-2)11-17(16)20)22-23(19(15)21)12-13-7-5-4-6-8-13/h4-11H,3,12,21H2,1-2H3 |
| InChIKey | HZIJGCCMGUTPOH-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.29 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |