3,3-difluorocyclopentane-1-sulfonyl chloride

C5H7ClF2O2S — CID 53417174

IUPAC3,3-difluorocyclopentane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1CCC(F)(F)C1
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)4-1-2-5(7,8)3-4/h4H,1-3H2
InChIKeyBMYSYKBVWVFQRH-UHFFFAOYSA-N
MW204.62 g/mol
LogP1.74
Rot. Bonds1

About 3,3-difluorocyclopentane-1-sulfonyl chloride

3,3-difluorocyclopentane-1-sulfonyl chloride (PubChem CID 53417174) has the molecular formula C5H7ClF2O2S and a molecular weight of 204.62 g/mol. Its IUPAC name is 3,3-difluorocyclopentane-1-sulfonyl chloride.

Molecular Properties

Compound Name3,3-difluorocyclopentane-1-sulfonyl chloride
PubChem CID53417174
Molecular FormulaC5H7ClF2O2S
Molecular Weight204.62 g/mol
Exact Mass203.98
IUPAC Name3,3-difluorocyclopentane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1CCC(F)(F)C1
InChIInChI=1S/C5H7ClF2O2S/c6-11(9,10)4-1-2-5(7,8)3-4/h4H,1-3H2
InChIKeyBMYSYKBVWVFQRH-UHFFFAOYSA-N
XLogP1.74
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.62
LogP ≤ 51.74
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 3,3-difluorocyclopentane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-Hexanesulfonyl chloride, 3,3,4,4,5,5,6,6,6-nonafluoro-
CID 119684
4,4,4-trifluorobutane-1-sulfonyl Chloride
CID 2761176
3,3,3-Trifluoropropane-1-sulfonyl chloride
CID 2761177
4,4,5,5,5-Pentafluoropentane-1-sulfonyl chloride
CID 21973190
3,3-Difluoropropane-1-sulfonyl chloride
CID 55263296
3-Fluorocyclopentane-1-sulfonyl chloride
CID 55263425
4,4-Difluorobutane-1-sulfonyl chloride
CID 84664402
3,3-Difluorobutane-1-sulfonyl chloride
CID 84664403
2,2-Difluorobutane-1-sulfonyl chloride
CID 105446602
2-Fluorocyclopentane-1-sulfonyl chloride
CID 119031671
3,3,4,4,4-Pentafluorobutane-1-sulfonyl chloride
CID 55279085
5,5,5-Trifluoropentane-1-sulfonyl chloride
CID 56604710

Frequently Asked Questions

What is the IUPAC name of 3,3-difluorocyclopentane-1-sulfonyl chloride?
The IUPAC name of 3,3-difluorocyclopentane-1-sulfonyl chloride (CID 53417174) is 3,3-difluorocyclopentane-1-sulfonyl chloride.
What is the SMILES notation for 3,3-difluorocyclopentane-1-sulfonyl chloride?
The canonical SMILES for 3,3-difluorocyclopentane-1-sulfonyl chloride is O=S(=O)(Cl)C1CCC(F)(F)C1.
What is the InChIKey of 3,3-difluorocyclopentane-1-sulfonyl chloride?
The InChIKey is BMYSYKBVWVFQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7ClF2O2S/c6-11(9,10)4-1-2-5(7,8)3-4/h4H,1-3H2.
What are the key properties of 3,3-difluorocyclopentane-1-sulfonyl chloride?
3,3-difluorocyclopentane-1-sulfonyl chloride has a molecular weight of 204.62 g/mol, XLogP of 1.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluorocyclopentane-1-sulfonyl chloride is sourced from PubChem (CID 53417174), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).