3-fluorocyclopentane-1-sulfonyl chloride

C5H8ClFO2S — CID 55263425

IUPAC3-fluorocyclopentane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1CCC(F)C1
InChIInChI=1S/C5H8ClFO2S/c6-10(8,9)5-2-1-4(7)3-5/h4-5H,1-3H2
InChIKeySKSMWASLDSBCBB-UHFFFAOYSA-N
MW186.63 g/mol
LogP1.45
Rot. Bonds1

About 3-fluorocyclopentane-1-sulfonyl chloride

3-fluorocyclopentane-1-sulfonyl chloride (PubChem CID 55263425) has the molecular formula C5H8ClFO2S and a molecular weight of 186.63 g/mol. Its IUPAC name is 3-fluorocyclopentane-1-sulfonyl chloride.

Molecular Properties

Compound Name3-fluorocyclopentane-1-sulfonyl chloride
PubChem CID55263425
Molecular FormulaC5H8ClFO2S
Molecular Weight186.63 g/mol
Exact Mass185.99
IUPAC Name3-fluorocyclopentane-1-sulfonyl chloride
SMILESO=S(=O)(Cl)C1CCC(F)C1
InChIInChI=1S/C5H8ClFO2S/c6-10(8,9)5-2-1-4(7)3-5/h4-5H,1-3H2
InChIKeySKSMWASLDSBCBB-UHFFFAOYSA-N
XLogP1.45
TPSA34.14 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500186.63
LogP ≤ 51.45
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze 3-fluorocyclopentane-1-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

Butanesulfonyl chloride, 4-fluoro-
CID 9739
Cyclopentanesulfonyl chloride
CID 3717197
Hexanesulfonyl chloride, 6-fluoro-
CID 9747
Cyclopentanesulfonyl fluoride
CID 22935857
3,3-Difluorocyclopentane-1-sulfonyl chloride
CID 53417174
2-Fluorocyclopentane-1-sulfonyl chloride
CID 119031671
5-Fluoropentane-1-sulfonyl chloride
CID 3029710
5,5,5-Trifluoropentane-1-sulfonyl chloride
CID 56604710
(3S)-3-fluorobutane-1-sulfonyl chloride
CID 124661264
(3R)-3-fluorobutane-1-sulfonyl chloride
CID 124661265
rac-(1R,3R)-3-fluorocyclopentane-1-sulfonyl chloride
CID 165915671
2-Fluorocyclopentane-1-sulfonic acid
CID 23054169

Frequently Asked Questions

What is the IUPAC name of 3-fluorocyclopentane-1-sulfonyl chloride?
The IUPAC name of 3-fluorocyclopentane-1-sulfonyl chloride (CID 55263425) is 3-fluorocyclopentane-1-sulfonyl chloride.
What is the SMILES notation for 3-fluorocyclopentane-1-sulfonyl chloride?
The canonical SMILES for 3-fluorocyclopentane-1-sulfonyl chloride is O=S(=O)(Cl)C1CCC(F)C1.
What is the InChIKey of 3-fluorocyclopentane-1-sulfonyl chloride?
The InChIKey is SKSMWASLDSBCBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8ClFO2S/c6-10(8,9)5-2-1-4(7)3-5/h4-5H,1-3H2.
What are the key properties of 3-fluorocyclopentane-1-sulfonyl chloride?
3-fluorocyclopentane-1-sulfonyl chloride has a molecular weight of 186.63 g/mol, XLogP of 1.45, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluorocyclopentane-1-sulfonyl chloride is sourced from PubChem (CID 55263425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).