C16H13Cl2FO2 — CID 53417192
3-(2,3-dichlorophenyl)-1-(3-fluoro-4-methoxyphenyl)propan-1-one (PubChem CID 53417192) has the molecular formula C16H13Cl2FO2 and a molecular weight of 327.18 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-(3-fluoro-4-methoxyphenyl)propan-1-one.
| Compound Name | 3-(2,3-dichlorophenyl)-1-(3-fluoro-4-methoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 53417192 |
| Molecular Formula | C16H13Cl2FO2 |
| Molecular Weight | 327.18 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-(3-fluoro-4-methoxyphenyl)propan-1-one |
| SMILES | COc1ccc(C(=O)CCc2cccc(Cl)c2Cl)cc1F |
| InChI | InChI=1S/C16H13Cl2FO2/c1-21-15-8-6-11(9-13(15)19)14(20)7-5-10-3-2-4-12(17)16(10)18/h2-4,6,8-9H,5,7H2,1H3 |
| InChIKey | GYNWWMKNXFEGDU-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.18 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |