C13H15N3O3 — CID 5342252
(5Z)-2-amino-5-[(3,4-dimethoxyphenyl)methylidene]-1-methylimidazol-4-one (PubChem CID 5342252) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (5Z)-2-amino-5-[(3,4-dimethoxyphenyl)methylidene]-1-methylimidazol-4-one.
| Compound Name | (5Z)-2-amino-5-[(3,4-dimethoxyphenyl)methylidene]-1-methylimidazol-4-one |
|---|---|
| PubChem CID | 5342252 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (5Z)-2-amino-5-[(3,4-dimethoxyphenyl)methylidene]-1-methylimidazol-4-one |
| SMILES | COc1ccc(/C=C2/C(=O)N=C(N)N2C)cc1OC |
| InChI | InChI=1S/C13H15N3O3/c1-16-9(12(17)15-13(16)14)6-8-4-5-10(18-2)11(7-8)19-3/h4-7H,1-3H3,(H2,14,15,17)/b9-6- |
| InChIKey | CZWAUTLDAMSCLA-TWGQIWQCSA-N |
| XLogP | 0.83 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|