About 7-bromo-1H-imidazo[4,5-b]pyridine
7-bromo-1H-imidazo[4,5-b]pyridine (PubChem CID 53423966) has the molecular formula C6H4BrN3
and a molecular weight of 198.02 g/mol. Its IUPAC name is 7-bromo-1H-imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 7-bromo-1H-imidazo[4,5-b]pyridine |
| PubChem CID | 53423966 |
| Molecular Formula | C6H4BrN3 |
| Molecular Weight | 198.02 g/mol |
| Exact Mass | 196.96 |
| IUPAC Name | 7-bromo-1H-imidazo[4,5-b]pyridine |
| SMILES | Brc1ccnc2nc[nH]c12 |
| InChI | InChI=1S/C6H4BrN3/c7-4-1-2-8-6-5(4)9-3-10-6/h1-3H,(H,8,9,10) |
| InChIKey | DEFSPWZHYXXHLB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.02 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-1H-imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1H-imidazo[4,5-b]pyridine?
The IUPAC name of 7-bromo-1H-imidazo[4,5-b]pyridine (CID 53423966) is 7-bromo-1H-imidazo[4,5-b]pyridine.
What is the SMILES notation for 7-bromo-1H-imidazo[4,5-b]pyridine?
The canonical SMILES for 7-bromo-1H-imidazo[4,5-b]pyridine is Brc1ccnc2nc[nH]c12.
What is the InChIKey of 7-bromo-1H-imidazo[4,5-b]pyridine?
The InChIKey is DEFSPWZHYXXHLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4BrN3/c7-4-1-2-8-6-5(4)9-3-10-6/h1-3H,(H,8,9,10).
What are the key properties of 7-bromo-1H-imidazo[4,5-b]pyridine?
7-bromo-1H-imidazo[4,5-b]pyridine has a molecular weight of 198.02 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1H-imidazo[4,5-b]pyridine is sourced from PubChem (CID 53423966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).