C26H29N3O3 — CID 53426451
ethyl 4-[1-[(2-benzylphenyl)methyl]imidazole-2-carbonyl]piperidine-1-carboxylate (PubChem CID 53426451) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is ethyl 4-[1-[(2-benzylphenyl)methyl]imidazole-2-carbonyl]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[1-[(2-benzylphenyl)methyl]imidazole-2-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 53426451 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | ethyl 4-[1-[(2-benzylphenyl)methyl]imidazole-2-carbonyl]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)c2nccn2Cc2ccccc2Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H29N3O3/c1-2-32-26(31)28-15-12-21(13-16-28)24(30)25-27-14-17-29(25)19-23-11-7-6-10-22(23)18-20-8-4-3-5-9-20/h3-11,14,17,21H,2,12-13,15-16,18-19H2,1H3 |
| InChIKey | UQAMQEMTKOKCMY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |