C25H27N3O3 — CID 11304622
ethyl 4-(1-benzhydrylimidazole-2-carbonyl)piperidine-1-carboxylate (PubChem CID 11304622) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 4-(1-benzhydrylimidazole-2-carbonyl)piperidine-1-carboxylate.
| Compound Name | ethyl 4-(1-benzhydrylimidazole-2-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11304622 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | ethyl 4-(1-benzhydrylimidazole-2-carbonyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(C(=O)c2nccn2C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N3O3/c1-2-31-25(30)27-16-13-21(14-17-27)23(29)24-26-15-18-28(24)22(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-12,15,18,21-22H,2,13-14,16-17H2,1H3 |
| InChIKey | HTRWASOYCOUDDY-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |