C28H30F3N5O7-2 — CID 53427280
but-2-enedioate;(4-nitrophenyl)-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]methanone (PubChem CID 53427280) has the molecular formula C28H30F3N5O7-2 and a molecular weight of 605.57 g/mol. Its IUPAC name is but-2-enedioate;(4-nitrophenyl)-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]methanone.
| Compound Name | but-2-enedioate;(4-nitrophenyl)-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 53427280 |
| Molecular Formula | C28H30F3N5O7-2 |
| Molecular Weight | 605.57 g/mol |
| Exact Mass | 605.21 |
| IUPAC Name | but-2-enedioate;(4-nitrophenyl)-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]methanone |
| SMILES | O=C([O-])C=CC(=O)[O-].O=C(c1ccc([N+](=O)[O-])cc1)N1CCN(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C24H28F3N5O3.C4H4O4/c25-24(26,27)20-2-1-3-22(18-20)30-14-10-28(11-15-30)8-9-29-12-16-31(17-13-29)23(33)19-4-6-21(7-5-19)32(34)35;5-3(6)1-2-4(7)8/h1-7,18H,8-17H2;1-2H,(H,5,6)(H,7,8)/p-2 |
| InChIKey | KGJCJLXGZWHTFH-UHFFFAOYSA-L |
| XLogP | 0.24 |
| TPSA | 153.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.57 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|