C27H37F3N4O6-2 — CID 53428715
but-2-enedioate;ethyl 2-methyl-2-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]propanoate (PubChem CID 53428715) has the molecular formula C27H37F3N4O6-2 and a molecular weight of 570.61 g/mol. Its IUPAC name is but-2-enedioate;ethyl 2-methyl-2-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]propanoate.
| Compound Name | but-2-enedioate;ethyl 2-methyl-2-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]propanoate |
|---|---|
| PubChem CID | 53428715 |
| Molecular Formula | C27H37F3N4O6-2 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | but-2-enedioate;ethyl 2-methyl-2-[4-[2-[4-[3-(trifluoromethyl)phenyl]piperazin-1-yl]ethyl]piperazin-1-yl]propanoate |
| SMILES | CCOC(=O)C(C)(C)N1CCN(CCN2CCN(c3cccc(C(F)(F)F)c3)CC2)CC1.O=C([O-])C=CC(=O)[O-] |
| InChI | InChI=1S/C23H35F3N4O2.C4H4O4/c1-4-32-21(31)22(2,3)30-16-12-28(13-17-30)9-8-27-10-14-29(15-11-27)20-7-5-6-19(18-20)23(24,25)26;5-3(6)1-2-4(7)8/h5-7,18H,4,8-17H2,1-3H3;1-2H,(H,5,6)(H,7,8)/p-2 |
| InChIKey | GWFQTXQCUXKTNE-UHFFFAOYSA-L |
| XLogP | -0.17 |
| TPSA | 119.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|