C20H19N3O3 — CID 5343180
2-methyl-N-[(E)-[4-(naphthalen-1-ylamino)-4-oxobutan-2-ylidene]amino]furan-3-carboxamide (PubChem CID 5343180) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 2-methyl-N-[(E)-[4-(naphthalen-1-ylamino)-4-oxobutan-2-ylidene]amino]furan-3-carboxamide.
| Compound Name | 2-methyl-N-[(E)-[4-(naphthalen-1-ylamino)-4-oxobutan-2-ylidene]amino]furan-3-carboxamide |
|---|---|
| PubChem CID | 5343180 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-methyl-N-[(E)-[4-(naphthalen-1-ylamino)-4-oxobutan-2-ylidene]amino]furan-3-carboxamide |
| SMILES | C/C(CC(=O)Nc1cccc2ccccc12)=N\NC(=O)c1ccoc1C |
| InChI | InChI=1S/C20H19N3O3/c1-13(22-23-20(25)16-10-11-26-14(16)2)12-19(24)21-18-9-5-7-15-6-3-4-8-17(15)18/h3-11H,12H2,1-2H3,(H,21,24)(H,23,25)/b22-13+ |
| InChIKey | QPLZZKJRZRWFST-LPYMAVHISA-N |
| XLogP | 3.88 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|