C13H17N — CID 53434523
4-(3,5-dimethylphenyl)-1,2,3,6-tetrahydropyridine (PubChem CID 53434523) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is 4-(3,5-dimethylphenyl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(3,5-dimethylphenyl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 53434523 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 4-(3,5-dimethylphenyl)-1,2,3,6-tetrahydropyridine |
| SMILES | Cc1cc(C)cc(C2=CCNCC2)c1 |
| InChI | InChI=1S/C13H17N/c1-10-7-11(2)9-13(8-10)12-3-5-14-6-4-12/h3,7-9,14H,4-6H2,1-2H3 |
| InChIKey | HQZKLAOFUNIYLZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |