About methyl 2-diazoacetate
methyl 2-diazoacetate (PubChem CID 53436957) has the molecular formula C3H4N2O2
and a molecular weight of 100.08 g/mol. Its IUPAC name is methyl 2-diazoacetate.
Molecular Properties
| Compound Name | methyl 2-diazoacetate |
| PubChem CID | 53436957 |
| Molecular Formula | C3H4N2O2 |
| Molecular Weight | 100.08 g/mol |
| Exact Mass | 100.03 |
| IUPAC Name | methyl 2-diazoacetate |
| SMILES | COC(=O)C=[N+]=[N-] |
| InChI | InChI=1S/C3H4N2O2/c1-7-3(6)2-5-4/h2H,1H3 |
| InChIKey | MIVRMHJOEYRXQB-UHFFFAOYSA-N |
| XLogP | -0.54 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.08 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-diazoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-diazoacetate?
The IUPAC name of methyl 2-diazoacetate (CID 53436957) is methyl 2-diazoacetate.
What is the SMILES notation for methyl 2-diazoacetate?
The canonical SMILES for methyl 2-diazoacetate is COC(=O)C=[N+]=[N-].
What is the InChIKey of methyl 2-diazoacetate?
The InChIKey is MIVRMHJOEYRXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2O2/c1-7-3(6)2-5-4/h2H,1H3.
What are the key properties of methyl 2-diazoacetate?
methyl 2-diazoacetate has a molecular weight of 100.08 g/mol, XLogP of -0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-diazoacetate is sourced from PubChem (CID 53436957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).