C17H15ClN2O5 — CID 5343902
(E)-3-(4-chloro-2-nitroanilino)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one (PubChem CID 5343902) has the molecular formula C17H15ClN2O5 and a molecular weight of 362.77 g/mol. Its IUPAC name is (E)-3-(4-chloro-2-nitroanilino)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-chloro-2-nitroanilino)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 5343902 |
| Molecular Formula | C17H15ClN2O5 |
| Molecular Weight | 362.77 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (E)-3-(4-chloro-2-nitroanilino)-1-(3,4-dimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)/C=C/Nc2ccc(Cl)cc2[N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C17H15ClN2O5/c1-24-16-6-3-11(9-17(16)25-2)15(21)7-8-19-13-5-4-12(18)10-14(13)20(22)23/h3-10,19H,1-2H3/b8-7+ |
| InChIKey | XTTXOJFKPVNGKM-BQYQJAHWSA-N |
| XLogP | 4.07 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.77 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|