About 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate
9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate (PubChem CID 53442786) has the molecular formula C19H20N2O2
and a molecular weight of 308.38 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate |
| PubChem CID | 53442786 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate |
| SMILES | NN1CCC(C(=O)OCC2c3ccccc3-c3ccccc32)C1 |
| InChI | InChI=1S/C19H20N2O2/c20-21-10-9-13(11-21)19(22)23-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12,20H2 |
| InChIKey | ACPOJNLODHRUAC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate?
The IUPAC name of 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate (CID 53442786) is 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate?
The canonical SMILES for 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate is NN1CCC(C(=O)OCC2c3ccccc3-c3ccccc32)C1.
What is the InChIKey of 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate?
The InChIKey is ACPOJNLODHRUAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N2O2/c20-21-10-9-13(11-21)19(22)23-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12,20H2.
What are the key properties of 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate?
9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate has a molecular weight of 308.38 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl 1-aminopyrrolidine-3-carboxylate is sourced from PubChem (CID 53442786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).