C21H32ClNO3 — CID 53447282
2-(1-hydroxycyclohexyl)-3-(1-methylpiperidin-3-yl)-2-phenylpropanoic acid;hydrochloride (PubChem CID 53447282) has the molecular formula C21H32ClNO3 and a molecular weight of 381.94 g/mol. Its IUPAC name is 2-(1-hydroxycyclohexyl)-3-(1-methylpiperidin-3-yl)-2-phenylpropanoic acid;hydrochloride.
| Compound Name | 2-(1-hydroxycyclohexyl)-3-(1-methylpiperidin-3-yl)-2-phenylpropanoic acid;hydrochloride |
|---|---|
| PubChem CID | 53447282 |
| Molecular Formula | C21H32ClNO3 |
| Molecular Weight | 381.94 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-(1-hydroxycyclohexyl)-3-(1-methylpiperidin-3-yl)-2-phenylpropanoic acid;hydrochloride |
| SMILES | CN1CCCC(CC(C(=O)O)(c2ccccc2)C2(O)CCCCC2)C1.Cl |
| InChI | InChI=1S/C21H31NO3.ClH/c1-22-14-8-9-17(16-22)15-21(19(23)24,18-10-4-2-5-11-18)20(25)12-6-3-7-13-20;/h2,4-5,10-11,17,25H,3,6-9,12-16H2,1H3,(H,23,24);1H |
| InChIKey | VFQAJZBEPWEZRN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.94 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |