C22H30O6 — CID 534591
dimethyl 8-formyl-12-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate (PubChem CID 534591) has the molecular formula C22H30O6 and a molecular weight of 390.48 g/mol. Its IUPAC name is dimethyl 8-formyl-12-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate.
| Compound Name | dimethyl 8-formyl-12-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 534591 |
| Molecular Formula | C22H30O6 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | dimethyl 8-formyl-12-hydroxy-4-methyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate |
| SMILES | C=C1CC23CC1(O)CCC2C1(C=O)CCCC(C)(C(=O)OC)C1C3C(=O)OC |
| InChI | InChI=1S/C22H30O6/c1-13-10-21-11-22(13,26)9-6-14(21)20(12-23)8-5-7-19(2,18(25)28-4)16(20)15(21)17(24)27-3/h12,14-16,26H,1,5-11H2,2-4H3 |
| InChIKey | BHCZWSIRDIJOBA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|