C25H38O6Si — CID 24883914
dimethyl (1R,8R,12R,14R)-8-formyl-4-methyl-13-methylidene-14-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate (PubChem CID 24883914) has the molecular formula C25H38O6Si and a molecular weight of 462.66 g/mol. Its IUPAC name is dimethyl (1R,8R,12R,14R)-8-formyl-4-methyl-13-methylidene-14-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate.
| Compound Name | dimethyl (1R,8R,12R,14R)-8-formyl-4-methyl-13-methylidene-14-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 24883914 |
| Molecular Formula | C25H38O6Si |
| Molecular Weight | 462.66 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | dimethyl (1R,8R,12R,14R)-8-formyl-4-methyl-13-methylidene-14-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate |
| SMILES | C=C1[C@@H]2CCC3[C@]4(C=O)CCCC(C)(C(=O)OC)C4C(C(=O)OC)[C@]3(C2)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C25H38O6Si/c1-15-16-9-10-17-24(14-26)12-8-11-23(2,22(28)30-4)19(24)18(21(27)29-3)25(17,13-16)20(15)31-32(5,6)7/h14,16-20H,1,8-13H2,2-7H3/t16-,17?,18?,19?,20-,23?,24-,25-/m1/s1 |
| InChIKey | QRVMXFJWFXKMBP-ZDVWXMTASA-N |
| XLogP | 4.15 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|