C26H40O7Si — CID 6431399
trimethyl (1R,2S,6R,8R,12R)-4-methyl-13-methylidene-6-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate (PubChem CID 6431399) has the molecular formula C26H40O7Si and a molecular weight of 492.69 g/mol. Its IUPAC name is trimethyl (1R,2S,6R,8R,12R)-4-methyl-13-methylidene-6-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate.
| Compound Name | trimethyl (1R,2S,6R,8R,12R)-4-methyl-13-methylidene-6-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate |
|---|---|
| PubChem CID | 6431399 |
| Molecular Formula | C26H40O7Si |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | trimethyl (1R,2S,6R,8R,12R)-4-methyl-13-methylidene-6-trimethylsilyloxytetracyclo[10.2.1.01,9.03,8]pentadecane-2,4,8-tricarboxylate |
| SMILES | C=C1C[C@]23C[C@H]1CCC2[C@]1(C(=O)OC)C[C@H](O[Si](C)(C)C)CC(C)(C(=O)OC)C1C3C(=O)OC |
| InChI | InChI=1S/C26H40O7Si/c1-15-11-25-12-16(15)9-10-18(25)26(23(29)32-5)14-17(33-34(6,7)8)13-24(2,22(28)31-4)20(26)19(25)21(27)30-3/h16-20H,1,9-14H2,2-8H3/t16-,17-,18?,19?,20?,24?,25+,26-/m1/s1 |
| InChIKey | ZVOYSZVAQICPHG-XWWCABRNSA-N |
| XLogP | 4.12 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|