C25H40O5Si2 — CID 162888272
bis(trimethylsilyl) (1R,2S,3S,4R,8S,9S,12R)-8-formyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate (PubChem CID 162888272) has the molecular formula C25H40O5Si2 and a molecular weight of 476.76 g/mol. Its IUPAC name is bis(trimethylsilyl) (1R,2S,3S,4R,8S,9S,12R)-8-formyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate.
| Compound Name | bis(trimethylsilyl) (1R,2S,3S,4R,8S,9S,12R)-8-formyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate |
|---|---|
| PubChem CID | 162888272 |
| Molecular Formula | C25H40O5Si2 |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | bis(trimethylsilyl) (1R,2S,3S,4R,8S,9S,12R)-8-formyl-13-methylidenetetracyclo[10.2.1.01,9.03,8]pentadecane-2,4-dicarboxylate |
| SMILES | C=C1C[C@]23C[C@H]1CC[C@@H]2[C@]1(C=O)CCC[C@@H](C(=O)O[Si](C)(C)C)[C@H]1[C@@H]3C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C25H40O5Si2/c1-16-13-25-14-17(16)10-11-19(25)24(15-26)12-8-9-18(22(27)29-31(2,3)4)20(24)21(25)23(28)30-32(5,6)7/h15,17-21H,1,8-14H2,2-7H3/t17-,18-,19-,20+,21-,24-,25+/m1/s1 |
| InChIKey | FYBDWRRBWHRIAY-CZIXYAIYSA-N |
| XLogP | 5.34 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|