C23H20ClNO — CID 53469709
(E)-1-(4-chlorophenyl)-N-[(E,1S)-1,3-diphenylprop-2-enoxy]ethanimine (PubChem CID 53469709) has the molecular formula C23H20ClNO and a molecular weight of 361.87 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-N-[(E,1S)-1,3-diphenylprop-2-enoxy]ethanimine.
| Compound Name | (E)-1-(4-chlorophenyl)-N-[(E,1S)-1,3-diphenylprop-2-enoxy]ethanimine |
|---|---|
| PubChem CID | 53469709 |
| Molecular Formula | C23H20ClNO |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.12 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-N-[(E,1S)-1,3-diphenylprop-2-enoxy]ethanimine |
| SMILES | C/C(=N\O[C@@H](/C=C/c1ccccc1)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H20ClNO/c1-18(20-13-15-22(24)16-14-20)25-26-23(21-10-6-3-7-11-21)17-12-19-8-4-2-5-9-19/h2-17,23H,1H3/b17-12+,25-18+/t23-/m0/s1 |
| InChIKey | DEMCYPUDZZGZGD-JUQVKQCNSA-N |
| XLogP | 6.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|