C15H22N2O — CID 534704
2-amino-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]furan-3-carbonitrile (PubChem CID 534704) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 2-amino-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]furan-3-carbonitrile.
| Compound Name | 2-amino-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]furan-3-carbonitrile |
|---|---|
| PubChem CID | 534704 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-amino-4,5,6,7,8,9,10,11,12,13-decahydrocyclododeca[b]furan-3-carbonitrile |
| SMILES | N#Cc1c(N)oc2c1CCCCCCCCCC2 |
| InChI | InChI=1S/C15H22N2O/c16-11-13-12-9-7-5-3-1-2-4-6-8-10-14(12)18-15(13)17/h1-10,17H2 |
| InChIKey | BWJWMXXUKFKKMQ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |