About 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine
2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine (PubChem CID 53470985) has the molecular formula C20H22ClN5S
and a molecular weight of 399.95 g/mol. Its IUPAC name is 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine.
Molecular Properties
| Compound Name | 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine |
| PubChem CID | 53470985 |
| Molecular Formula | C20H22ClN5S |
| Molecular Weight | 399.95 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine |
| SMILES | Cc1nc2ccccc2c(/N=C(\N)N(c2nccs2)C2CCCCC2)c1Cl |
| InChI | InChI=1S/C20H22ClN5S/c1-13-17(21)18(15-9-5-6-10-16(15)24-13)25-19(22)26(20-23-11-12-27-20)14-7-3-2-4-8-14/h5-6,9-12,14H,2-4,7-8H2,1H3,(H2,22,24,25) |
| InChIKey | JKOASHOBDUEAAB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 67.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 399.95 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine?
The IUPAC name of 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine (CID 53470985) is 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine.
What is the SMILES notation for 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine?
The canonical SMILES for 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine is Cc1nc2ccccc2c(/N=C(\N)N(c2nccs2)C2CCCCC2)c1Cl.
What is the InChIKey of 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine?
The InChIKey is JKOASHOBDUEAAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22ClN5S/c1-13-17(21)18(15-9-5-6-10-16(15)24-13)25-19(22)26(20-23-11-12-27-20)14-7-3-2-4-8-14/h5-6,9-12,14H,2-4,7-8H2,1H3,(H2,22,24,25).
What are the key properties of 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine?
2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine has a molecular weight of 399.95 g/mol, XLogP of 5.44, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chloro-2-methylquinolin-4-yl)-1-cyclohexyl-1-(1,3-thiazol-2-yl)guanidine is sourced from PubChem (CID 53470985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).