C23H22N4S — CID 2976095
2-[4-(2-methylquinolin-4-yl)piperazin-1-yl]-4-phenyl-1,3-thiazole (PubChem CID 2976095) has the molecular formula C23H22N4S and a molecular weight of 386.52 g/mol. Its IUPAC name is 2-[4-(2-methylquinolin-4-yl)piperazin-1-yl]-4-phenyl-1,3-thiazole.
| Compound Name | 2-[4-(2-methylquinolin-4-yl)piperazin-1-yl]-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 2976095 |
| Molecular Formula | C23H22N4S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-[4-(2-methylquinolin-4-yl)piperazin-1-yl]-4-phenyl-1,3-thiazole |
| SMILES | Cc1cc(N2CCN(c3nc(-c4ccccc4)cs3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C23H22N4S/c1-17-15-22(19-9-5-6-10-20(19)24-17)26-11-13-27(14-12-26)23-25-21(16-28-23)18-7-3-2-4-8-18/h2-10,15-16H,11-14H2,1H3 |
| InChIKey | HTZQTFJZCQZKBO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |